C18H30N6 — CID 19138370
4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-ethylpiperazin-1-yl)pyrimidine-4,5-diamine (PubChem CID 19138370) has the molecular formula C18H30N6 and a molecular weight of 330.48 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-ethylpiperazin-1-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-ethylpiperazin-1-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19138370 |
| Molecular Formula | C18H30N6 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-ethylpiperazin-1-yl)pyrimidine-4,5-diamine |
| SMILES | CCN1CCN(c2ncnc(NCCC3=CCCCC3)c2N)CC1 |
| InChI | InChI=1S/C18H30N6/c1-2-23-10-12-24(13-11-23)18-16(19)17(21-14-22-18)20-9-8-15-6-4-3-5-7-15/h6,14H,2-5,7-13,19H2,1H3,(H,20,21,22) |
| InChIKey | PHZOIOLZFOBFRB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|