C18H29N5 — CID 112885536
N-[2-(cyclohexen-1-yl)ethyl]-4-(4-ethylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112885536) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(4-ethylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(4-ethylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112885536 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(4-ethylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CCN1CCN(c2ccnc(NCCC3=CCCCC3)n2)CC1 |
| InChI | InChI=1S/C18H29N5/c1-2-22-12-14-23(15-13-22)17-9-11-20-18(21-17)19-10-8-16-6-4-3-5-7-16/h6,9,11H,2-5,7-8,10,12-15H2,1H3,(H,19,20,21) |
| InChIKey | PCRDXIUMERJAQX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|