C21H27FN6 — CID 112943154
N-[2-(cyclohexen-1-yl)ethyl]-5-[4-(4-fluorophenyl)piperazin-1-yl]-1,2,4-triazin-3-amine (PubChem CID 112943154) has the molecular formula C21H27FN6 and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-[4-(4-fluorophenyl)piperazin-1-yl]-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[4-(4-fluorophenyl)piperazin-1-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112943154 |
| Molecular Formula | C21H27FN6 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[4-(4-fluorophenyl)piperazin-1-yl]-1,2,4-triazin-3-amine |
| SMILES | Fc1ccc(N2CCN(c3cnnc(NCCC4=CCCCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H27FN6/c22-18-6-8-19(9-7-18)27-12-14-28(15-13-27)20-16-24-26-21(25-20)23-11-10-17-4-2-1-3-5-17/h4,6-9,16H,1-3,5,10-15H2,(H,23,25,26) |
| InChIKey | OZZDBXJISDSUDP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|