C18H29N5 — CID 112943182
N-[2-(cyclohexen-1-yl)ethyl]-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112943182) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112943182 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CCC1CCCCN1c1cnnc(NCCC2=CCCCC2)n1 |
| InChI | InChI=1S/C18H29N5/c1-2-16-10-6-7-13-23(16)17-14-20-22-18(21-17)19-12-11-15-8-4-3-5-9-15/h8,14,16H,2-7,9-13H2,1H3,(H,19,21,22) |
| InChIKey | IWOPKRDRSYUEBK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|