C20H32N4 — CID 112869387
N-[2-(cyclohexen-1-yl)ethyl]-6-(2-ethylpiperidin-1-yl)-2-methylpyrimidin-4-amine (PubChem CID 112869387) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-6-(2-ethylpiperidin-1-yl)-2-methylpyrimidin-4-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-6-(2-ethylpiperidin-1-yl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112869387 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-6-(2-ethylpiperidin-1-yl)-2-methylpyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1cc(NCCC2=CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C20H32N4/c1-3-18-11-7-8-14-24(18)20-15-19(22-16(2)23-20)21-13-12-17-9-5-4-6-10-17/h9,15,18H,3-8,10-14H2,1-2H3,(H,21,22,23) |
| InChIKey | GDOKTQBUROPCNV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|