C21H30N4O — CID 112874201
6-(2-ethylpiperidin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine (PubChem CID 112874201) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 6-(2-ethylpiperidin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(2-ethylpiperidin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112874201 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 6-(2-ethylpiperidin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1cc(NCCc2cccc(OC)c2)nc(C)n1 |
| InChI | InChI=1S/C21H30N4O/c1-4-18-9-5-6-13-25(18)21-15-20(23-16(2)24-21)22-12-11-17-8-7-10-19(14-17)26-3/h7-8,10,14-15,18H,4-6,9,11-13H2,1-3H3,(H,22,23,24) |
| InChIKey | RVZUTODUIHTMKZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |