C16H20ClN5 — CID 112960398
N-(4-chlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112960398) has the molecular formula C16H20ClN5 and a molecular weight of 317.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-(4-chlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112960398 |
| Molecular Formula | C16H20ClN5 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(4-chlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CCC1CCCCN1c1cnnc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H20ClN5/c1-2-14-5-3-4-10-22(14)15-11-18-21-16(20-15)19-13-8-6-12(17)7-9-13/h6-9,11,14H,2-5,10H2,1H3,(H,19,20,21) |
| InChIKey | UNBWFOVASXBEHH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |