C16H19Cl2N5 — CID 112960463
N-(2,3-dichlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112960463) has the molecular formula C16H19Cl2N5 and a molecular weight of 352.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-(2,3-dichlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112960463 |
| Molecular Formula | C16H19Cl2N5 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(2,3-dichlorophenyl)-5-(2-ethylpiperidin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CCC1CCCCN1c1cnnc(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C16H19Cl2N5/c1-2-11-6-3-4-9-23(11)14-10-19-22-16(21-14)20-13-8-5-7-12(17)15(13)18/h5,7-8,10-11H,2-4,6,9H2,1H3,(H,20,21,22) |
| InChIKey | DBYKSLNCALWODI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |