C19H26N8 — CID 112943170
N-[2-(cyclohexen-1-yl)ethyl]-5-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112943170) has the molecular formula C19H26N8 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112943170 |
| Molecular Formula | C19H26N8 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | C1=C(CCNc2nncc(N3CCN(c4ncccn4)CC3)n2)CCCC1 |
| InChI | InChI=1S/C19H26N8/c1-2-5-16(6-3-1)7-10-20-18-24-17(15-23-25-18)26-11-13-27(14-12-26)19-21-8-4-9-22-19/h4-5,8-9,15H,1-3,6-7,10-14H2,(H,20,24,25) |
| InChIKey | KNFUPUZECKLBKJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|