C22H28N6O — CID 109152726
[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109152726) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is [6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109152726 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | [6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(NCCC2=CCCCC2)nc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H28N6O/c29-21(27-13-15-28(16-14-27)22-24-10-4-11-25-22)19-7-8-20(26-17-19)23-12-9-18-5-2-1-3-6-18/h4-5,7-8,10-11,17H,1-3,6,9,12-16H2,(H,23,26) |
| InChIKey | WIFWRSGSLPHGLY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|