C18H27N3O — CID 109152727
6-[2-(cyclohexen-1-yl)ethylamino]-N,N-diethylpyridine-3-carboxamide (PubChem CID 109152727) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 6-[2-(cyclohexen-1-yl)ethylamino]-N,N-diethylpyridine-3-carboxamide.
| Compound Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N,N-diethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109152727 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N,N-diethylpyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NCCC2=CCCCC2)nc1 |
| InChI | InChI=1S/C18H27N3O/c1-3-21(4-2)18(22)16-10-11-17(20-14-16)19-13-12-15-8-6-5-7-9-15/h8,10-11,14H,3-7,9,12-13H2,1-2H3,(H,19,20) |
| InChIKey | YDOQKNQTMDBJNN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|