C19H27N3O3S — CID 109152718
6-[2-(cyclohexen-1-yl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-3-carboxamide (PubChem CID 109152718) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 6-[2-(cyclohexen-1-yl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109152718 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-3-carboxamide |
| SMILES | CN(C(=O)c1ccc(NCCC2=CCCCC2)nc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H27N3O3S/c1-22(17-10-12-26(24,25)14-17)19(23)16-7-8-18(21-13-16)20-11-9-15-5-3-2-4-6-15/h5,7-8,13,17H,2-4,6,9-12,14H2,1H3,(H,20,21) |
| InChIKey | UFNLSAYMGDWYSU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|