C22H27N3O2 — CID 109152703
6-[2-(cyclohexen-1-yl)ethylamino]-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 109152703) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 6-[2-(cyclohexen-1-yl)ethylamino]-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109152703 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(NCCC3=CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-27-20-10-7-18(8-11-20)15-25-22(26)19-9-12-21(24-16-19)23-14-13-17-5-3-2-4-6-17/h5,7-12,16H,2-4,6,13-15H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | ZKCGMIXPRPIHNE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|