C19H29N3O — CID 113010230
N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-ethylbutanamide (PubChem CID 113010230) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-ethylbutanamide.
| Compound Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113010230 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(NCCC2=CCCCC2)nc1 |
| InChI | InChI=1S/C19H29N3O/c1-3-16(4-2)19(23)22-17-10-11-18(21-14-17)20-13-12-15-8-6-5-7-9-15/h8,10-11,14,16H,3-7,9,12-13H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | XLFJMNMHEZUXHK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|