C21H25N3O — CID 113010234
N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-methylbenzamide (PubChem CID 113010234) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-methylbenzamide.
| Compound Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 113010234 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(NCCC2=CCCCC2)nc1 |
| InChI | InChI=1S/C21H25N3O/c1-16-7-5-6-10-19(16)21(25)24-18-11-12-20(23-15-18)22-14-13-17-8-3-2-4-9-17/h5-8,10-12,15H,2-4,9,13-14H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | PJLZMQMIGGCHFS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|