C13H20N4 — CID 82055043
N-[2-(cyclohexen-1-yl)ethyl]-5-hydrazinylpyridin-2-amine (PubChem CID 82055043) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-hydrazinylpyridin-2-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 82055043 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-hydrazinylpyridin-2-amine |
| SMILES | NNc1ccc(NCCC2=CCCCC2)nc1 |
| InChI | InChI=1S/C13H20N4/c14-17-12-6-7-13(16-10-12)15-9-8-11-4-2-1-3-5-11/h4,6-7,10,17H,1-3,5,8-9,14H2,(H,15,16) |
| InChIKey | BULDOSZDBSUQRX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|