C16H23N3O2 — CID 113024981
ethyl N-[5-[2-(cyclohexen-1-yl)ethylamino]-2-pyridinyl]carbamate (PubChem CID 113024981) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl N-[5-[2-(cyclohexen-1-yl)ethylamino]-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[5-[2-(cyclohexen-1-yl)ethylamino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113024981 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | ethyl N-[5-[2-(cyclohexen-1-yl)ethylamino]-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCCC2=CCCCC2)cn1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-21-16(20)19-15-9-8-14(12-18-15)17-11-10-13-6-4-3-5-7-13/h6,8-9,12,17H,2-5,7,10-11H2,1H3,(H,18,19,20) |
| InChIKey | NVYFJOBMLNNMHQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|