C16H18FN3O2 — CID 113028219
ethyl N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]carbamate (PubChem CID 113028219) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is ethyl N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113028219 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | ethyl N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCCc2ccccc2F)cn1 |
| InChI | InChI=1S/C16H18FN3O2/c1-2-22-16(21)20-15-8-7-13(11-19-15)18-10-9-12-5-3-4-6-14(12)17/h3-8,11,18H,2,9-10H2,1H3,(H,19,20,21) |
| InChIKey | MGDCXVPTHLBHSE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |