C16H19N3O3 — CID 113027367
ethyl N-[5-[(2-methoxyphenyl)methylamino]-2-pyridinyl]carbamate (PubChem CID 113027367) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is ethyl N-[5-[(2-methoxyphenyl)methylamino]-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[5-[(2-methoxyphenyl)methylamino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113027367 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | ethyl N-[5-[(2-methoxyphenyl)methylamino]-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccccc2OC)cn1 |
| InChI | InChI=1S/C16H19N3O3/c1-3-22-16(20)19-15-9-8-13(11-18-15)17-10-12-6-4-5-7-14(12)21-2/h4-9,11,17H,3,10H2,1-2H3,(H,18,19,20) |
| InChIKey | RCRMTRJQFVHFCS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |