C20H21F2N3O — CID 113010267
N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-3,4-difluorobenzamide (PubChem CID 113010267) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-3,4-difluorobenzamide.
| Compound Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113010267 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[6-[2-(cyclohexen-1-yl)ethylamino]-3-pyridinyl]-3,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(NCCC2=CCCCC2)nc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H21F2N3O/c21-17-8-6-15(12-18(17)22)20(26)25-16-7-9-19(24-13-16)23-11-10-14-4-2-1-3-5-14/h4,6-9,12-13H,1-3,5,10-11H2,(H,23,24)(H,25,26) |
| InChIKey | WAWLYVGARQBWDE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|