C22H27N3O2 — CID 109166702
2-[2-(cyclohexen-1-yl)ethylamino]-N-(4-ethoxyphenyl)pyridine-4-carboxamide (PubChem CID 109166702) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-N-(4-ethoxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-(4-ethoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166702 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-(4-ethoxyphenyl)pyridine-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccnc(NCCC3=CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-2-27-20-10-8-19(9-11-20)25-22(26)18-13-15-24-21(16-18)23-14-12-17-6-4-3-5-7-17/h6,8-11,13,15-16H,2-5,7,12,14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | IZROEMBFRHUOOW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|