C22H27N3O — CID 109166653
2-[2-(cyclohexen-1-yl)ethylamino]-N-(1-phenylethyl)pyridine-4-carboxamide (PubChem CID 109166653) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-N-(1-phenylethyl)pyridine-4-carboxamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-(1-phenylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166653 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-(1-phenylethyl)pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccnc(NCCC2=CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O/c1-17(19-10-6-3-7-11-19)25-22(26)20-13-15-24-21(16-20)23-14-12-18-8-4-2-5-9-18/h3,6-8,10-11,13,15-17H,2,4-5,9,12,14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | WCOVUSONTUOLDB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|