C22H24N4O — CID 53126653
N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine (PubChem CID 53126653) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 53126653 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
| SMILES | Cc1ccc(-c2noc(-c3ccc(NCCC4=CCCCC4)nc3)n2)cc1 |
| InChI | InChI=1S/C22H24N4O/c1-16-7-9-18(10-8-16)21-25-22(27-26-21)19-11-12-20(24-15-19)23-14-13-17-5-3-2-4-6-17/h5,7-12,15H,2-4,6,13-14H2,1H3,(H,23,24) |
| InChIKey | MNMRYJHHPZUODV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|