C23H22FN3O2 — CID 50828875
N-[2-(cyclohexen-1-yl)ethyl]-4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]benzamide (PubChem CID 50828875) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 50828875 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(-c2nc(-c3ccc(F)cc3)no2)cc1 |
| InChI | InChI=1S/C23H22FN3O2/c24-20-12-10-17(11-13-20)21-26-23(29-27-21)19-8-6-18(7-9-19)22(28)25-15-14-16-4-2-1-3-5-16/h4,6-13H,1-3,5,14-15H2,(H,25,28) |
| InChIKey | RCEGJRAEGSGCTA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|