C21H21FN4O — CID 53196932
N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide (PubChem CID 53196932) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 53196932 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccn2c(-c3ccc(F)cc3)nnc2c1 |
| InChI | InChI=1S/C21H21FN4O/c22-18-8-6-16(7-9-18)20-25-24-19-14-17(11-13-26(19)20)21(27)23-12-10-15-4-2-1-3-5-15/h4,6-9,11,13-14H,1-3,5,10,12H2,(H,23,27) |
| InChIKey | ZCYMWWJZHIGBIT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|