C22H25N3O2 — CID 109052433
1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-(pyridin-2-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 109052433) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-(pyridin-2-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-(pyridin-2-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109052433 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-3-N-(pyridin-2-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cccc(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C22H25N3O2/c26-21(24-14-12-17-7-2-1-3-8-17)18-9-6-10-19(15-18)22(27)25-16-20-11-4-5-13-23-20/h4-7,9-11,13,15H,1-3,8,12,14,16H2,(H,24,26)(H,25,27) |
| InChIKey | HNTSWXZMLBPNIH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|