C21H31N3O2 — CID 109052414
3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(dimethylamino)propyl]benzene-1,3-dicarboxamide (PubChem CID 109052414) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(dimethylamino)propyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(dimethylamino)propyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109052414 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(dimethylamino)propyl]benzene-1,3-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C21H31N3O2/c1-24(2)15-7-13-22-20(25)18-10-6-11-19(16-18)21(26)23-14-12-17-8-4-3-5-9-17/h6,8,10-11,16H,3-5,7,9,12-15H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | KJPBSQREZCMBSL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|