C25H25FN4O — CID 46322394
N-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(4-fluorophenyl)pyridazin-3-yl]amino]benzamide (PubChem CID 46322394) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(4-fluorophenyl)pyridazin-3-yl]amino]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(4-fluorophenyl)pyridazin-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 46322394 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(4-fluorophenyl)pyridazin-3-yl]amino]benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cccc(Nc2ccc(-c3ccc(F)cc3)nn2)c1 |
| InChI | InChI=1S/C25H25FN4O/c26-21-11-9-19(10-12-21)23-13-14-24(30-29-23)28-22-8-4-7-20(17-22)25(31)27-16-15-18-5-2-1-3-6-18/h4-5,7-14,17H,1-3,6,15-16H2,(H,27,31)(H,28,30) |
| InChIKey | NNJYUGHFXAUFMN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|