C25H21FN4O — CID 46322463
3-[[6-(3-fluorophenyl)pyridazin-3-yl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 46322463) has the molecular formula C25H21FN4O and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-[[6-(3-fluorophenyl)pyridazin-3-yl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 3-[[6-(3-fluorophenyl)pyridazin-3-yl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 46322463 |
| Molecular Formula | C25H21FN4O |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-[[6-(3-fluorophenyl)pyridazin-3-yl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1cccc(Nc2ccc(-c3cccc(F)c3)nn2)c1 |
| InChI | InChI=1S/C25H21FN4O/c26-21-10-4-8-19(16-21)23-12-13-24(30-29-23)28-22-11-5-9-20(17-22)25(31)27-15-14-18-6-2-1-3-7-18/h1-13,16-17H,14-15H2,(H,27,31)(H,28,30) |
| InChIKey | ZELKTQYLXXGYLP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |