C26H23N3O — CID 164589633
N-(2-phenylethyl)-3-[(5-phenyl-2-pyridinyl)amino]benzamide (PubChem CID 164589633) has the molecular formula C26H23N3O and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(2-phenylethyl)-3-[(5-phenyl-2-pyridinyl)amino]benzamide.
| Compound Name | N-(2-phenylethyl)-3-[(5-phenyl-2-pyridinyl)amino]benzamide |
|---|---|
| PubChem CID | 164589633 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-(2-phenylethyl)-3-[(5-phenyl-2-pyridinyl)amino]benzamide |
| SMILES | O=C(NCCc1ccccc1)c1cccc(Nc2ccc(-c3ccccc3)cn2)c1 |
| InChI | InChI=1S/C26H23N3O/c30-26(27-17-16-20-8-3-1-4-9-20)22-12-7-13-24(18-22)29-25-15-14-23(19-28-25)21-10-5-2-6-11-21/h1-15,18-19H,16-17H2,(H,27,30)(H,28,29) |
| InChIKey | VBLPDEMKBGKWTG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |