C26H27N3O3 — CID 46387080
N-[2-(cyclohexen-1-yl)ethyl]-3-[6-(3-methoxyphenoxy)pyridazin-3-yl]benzamide (PubChem CID 46387080) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[6-(3-methoxyphenoxy)pyridazin-3-yl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[6-(3-methoxyphenoxy)pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 46387080 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[6-(3-methoxyphenoxy)pyridazin-3-yl]benzamide |
| SMILES | COc1cccc(Oc2ccc(-c3cccc(C(=O)NCCC4=CCCCC4)c3)nn2)c1 |
| InChI | InChI=1S/C26H27N3O3/c1-31-22-11-6-12-23(18-22)32-25-14-13-24(28-29-25)20-9-5-10-21(17-20)26(30)27-16-15-19-7-3-2-4-8-19/h5-7,9-14,17-18H,2-4,8,15-16H2,1H3,(H,27,30) |
| InChIKey | OSHVVAXDOVUXRO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|