C16H25N5 — CID 112941997
N-[2-(cyclohexen-1-yl)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine (PubChem CID 112941997) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112941997 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine |
| SMILES | C1=C(CCNc2cnnc(N3CCCCC3)n2)CCCC1 |
| InChI | InChI=1S/C16H25N5/c1-3-7-14(8-4-1)9-10-17-15-13-18-20-16(19-15)21-11-5-2-6-12-21/h7,13H,1-6,8-12H2,(H,17,19,20) |
| InChIKey | NEZVCQUUZYWAOR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|