C17H24N6O2S — CID 112955931
4-[2-[[3-(azepan-1-yl)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide (PubChem CID 112955931) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-[2-[[3-(azepan-1-yl)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[3-(azepan-1-yl)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112955931 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-[2-[[3-(azepan-1-yl)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2cnnc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H24N6O2S/c18-26(24,25)15-7-5-14(6-8-15)9-10-19-16-13-20-22-17(21-16)23-11-3-1-2-4-12-23/h5-8,13H,1-4,9-12H2,(H2,18,24,25)(H,19,21,22) |
| InChIKey | YEZYMEZMISQSPB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |