C19H22N6O2S — CID 112955946
4-[2-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide (PubChem CID 112955946) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is 4-[2-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112955946 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-[2-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCN(c1ccccc1)c1nncc(NCCc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C19H22N6O2S/c1-2-25(16-6-4-3-5-7-16)19-23-18(14-22-24-19)21-13-12-15-8-10-17(11-9-15)28(20,26)27/h3-11,14H,2,12-13H2,1H3,(H2,20,26,27)(H,21,23,24) |
| InChIKey | YFRLVVDQGJAGDO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |