C20H23N5O2S — CID 112922513
4-[2-[[6-methyl-2-(N-methylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 112922513) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[2-[[6-methyl-2-(N-methylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-methyl-2-(N-methylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112922513 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[2-[[6-methyl-2-(N-methylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(NCCc2ccc(S(N)(=O)=O)cc2)nc(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C20H23N5O2S/c1-15-14-19(24-20(23-15)25(2)17-6-4-3-5-7-17)22-13-12-16-8-10-18(11-9-16)28(21,26)27/h3-11,14H,12-13H2,1-2H3,(H2,21,26,27)(H,22,23,24) |
| InChIKey | MKEISTPPZQKXFN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |