C22H28N4 — CID 112934210
N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 112934210) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112934210 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | C1=C(CCNc2cc(-c3ccccc3)nc(N3CCCC3)n2)CCCC1 |
| InChI | InChI=1S/C22H28N4/c1-3-9-18(10-4-1)13-14-23-21-17-20(19-11-5-2-6-12-19)24-22(25-21)26-15-7-8-16-26/h2,5-6,9,11-12,17H,1,3-4,7-8,10,13-16H2,(H,23,24,25) |
| InChIKey | OLAUZJODGOOUFP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|