C19H30N4 — CID 112911109
N-[2-(cyclohexen-1-yl)ethyl]-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine (PubChem CID 112911109) has the molecular formula C19H30N4 and a molecular weight of 314.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112911109 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCCC2=CCCCC2)nc(N2CCCC(C)C2)n1 |
| InChI | InChI=1S/C19H30N4/c1-15-7-6-12-23(14-15)19-21-16(2)13-18(22-19)20-11-10-17-8-4-3-5-9-17/h8,13,15H,3-7,9-12,14H2,1-2H3,(H,20,21,22) |
| InChIKey | IUHFMLGKMAKESX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|