C22H30N4O — CID 112880214
4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(3-methoxypropyl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880214) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(3-methoxypropyl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(3-methoxypropyl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880214 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(3-methoxypropyl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | COCCCNc1cc(NCCC2=CCCCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H30N4O/c1-27-16-8-14-23-20-17-21(24-15-13-18-9-4-2-5-10-18)26-22(25-20)19-11-6-3-7-12-19/h3,6-7,9,11-12,17H,2,4-5,8,10,13-16H2,1H3,(H2,23,24,25,26) |
| InChIKey | YXQYLCQVMVCGQA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|