C21H28N6 — CID 4670469
4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 4670469) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 4670469 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-2-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | C1=C(CCNc2nc(Nc3ccccc3)nc(N3CCCC3)n2)CCCC1 |
| InChI | InChI=1S/C21H28N6/c1-3-9-17(10-4-1)13-14-22-19-24-20(23-18-11-5-2-6-12-18)26-21(25-19)27-15-7-8-16-27/h2,5-6,9,11-12H,1,3-4,7-8,10,13-16H2,(H2,22,23,24,25,26) |
| InChIKey | OURFHYIKZDUNQC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|