C20H24N4O — CID 109323426
2-anilino-N-[2-(cyclohexen-1-yl)ethyl]-6-methylpyrimidine-4-carboxamide (PubChem CID 109323426) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-anilino-N-[2-(cyclohexen-1-yl)ethyl]-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-anilino-N-[2-(cyclohexen-1-yl)ethyl]-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323426 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-anilino-N-[2-(cyclohexen-1-yl)ethyl]-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCC2=CCCCC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H24N4O/c1-15-14-18(19(25)21-13-12-16-8-4-2-5-9-16)24-20(22-15)23-17-10-6-3-7-11-17/h3,6-8,10-11,14H,2,4-5,9,12-13H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | CXWHQLGESFHEBD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|