C22H28N4O — CID 109323433
N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylanilino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109323433) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylanilino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylanilino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323433 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylanilino)-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1ccc(Nc2nc(C)cc(C(=O)NCCC3=CCCCC3)n2)c(C)c1 |
| InChI | InChI=1S/C22H28N4O/c1-15-9-10-19(16(2)13-15)25-22-24-17(3)14-20(26-22)21(27)23-12-11-18-7-5-4-6-8-18/h7,9-10,13-14H,4-6,8,11-12H2,1-3H3,(H,23,27)(H,24,25,26) |
| InChIKey | QELMDLCMZCRGJJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|