C20H23FN4O — CID 109323473
N-[2-(cyclohexen-1-yl)ethyl]-2-(3-fluoroanilino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109323473) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(3-fluoroanilino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(3-fluoroanilino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323473 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(3-fluoroanilino)-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCC2=CCCCC2)nc(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H23FN4O/c1-14-12-18(19(26)22-11-10-15-6-3-2-4-7-15)25-20(23-14)24-17-9-5-8-16(21)13-17/h5-6,8-9,12-13H,2-4,7,10-11H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | XMWVZZAGLDYQIT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|