C23H31N5O — CID 112885578
N-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine (PubChem CID 112885578) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112885578 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine |
| SMILES | COc1ccccc1N1CCN(c2ccnc(NCCC3=CCCCC3)n2)CC1 |
| InChI | InChI=1S/C23H31N5O/c1-29-21-10-6-5-9-20(21)27-15-17-28(18-16-27)22-12-14-25-23(26-22)24-13-11-19-7-3-2-4-8-19/h5-7,9-10,12,14H,2-4,8,11,13,15-18H2,1H3,(H,24,25,26) |
| InChIKey | MQRDOYDDRYRSBU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|