C20H27N7 — CID 112942990
N-[2-(cyclohexen-1-yl)ethyl]-3-(4-pyridin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine (PubChem CID 112942990) has the molecular formula C20H27N7 and a molecular weight of 365.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(4-pyridin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-pyridin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112942990 |
| Molecular Formula | C20H27N7 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-pyridin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine |
| SMILES | C1=C(CCNc2cnnc(N3CCN(c4ccccn4)CC3)n2)CCCC1 |
| InChI | InChI=1S/C20H27N7/c1-2-6-17(7-3-1)9-11-21-18-16-23-25-20(24-18)27-14-12-26(13-15-27)19-8-4-5-10-22-19/h4-6,8,10,16H,1-3,7,9,11-15H2,(H,21,24,25) |
| InChIKey | FOIFVSYODVRJNU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|