C10H19N7 — CID 19138427
4-(4-ethylpiperazin-1-yl)-6-hydrazinylpyrimidin-5-amine (PubChem CID 19138427) has the molecular formula C10H19N7 and a molecular weight of 237.31 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-6-hydrazinylpyrimidin-5-amine.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-6-hydrazinylpyrimidin-5-amine |
|---|---|
| PubChem CID | 19138427 |
| Molecular Formula | C10H19N7 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-6-hydrazinylpyrimidin-5-amine |
| SMILES | CCN1CCN(c2ncnc(NN)c2N)CC1 |
| InChI | InChI=1S/C10H19N7/c1-2-16-3-5-17(6-4-16)10-8(11)9(15-12)13-7-14-10/h7H,2-6,11-12H2,1H3,(H,13,14,15) |
| InChIKey | VVYURODASJQNPQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|