C16H29N5 — CID 80749906
6-(4-ethylpiperazin-1-yl)-5-propan-2-yl-N-propylpyrimidin-4-amine (PubChem CID 80749906) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-5-propan-2-yl-N-propylpyrimidin-4-amine.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-5-propan-2-yl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80749906 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-5-propan-2-yl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(N2CCN(CC)CC2)c1C(C)C |
| InChI | InChI=1S/C16H29N5/c1-5-7-17-15-14(13(3)4)16(19-12-18-15)21-10-8-20(6-2)9-11-21/h12-13H,5-11H2,1-4H3,(H,17,18,19) |
| InChIKey | ZVBURKOTRKHUQI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |