C24H32N6O2 — CID 22525973
N-[2-(cyclohexen-1-yl)ethyl]-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 22525973) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22525973 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1cccc(N2CCN(c3ncnc(NCCC4=CCCCC4)c3[N+](=O)[O-])CC2)c1C |
| InChI | InChI=1S/C24H32N6O2/c1-18-7-6-10-21(19(18)2)28-13-15-29(16-14-28)24-22(30(31)32)23(26-17-27-24)25-12-11-20-8-4-3-5-9-20/h6-8,10,17H,3-5,9,11-16H2,1-2H3,(H,25,26,27) |
| InChIKey | LNYPRVHBBFJYRU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|