C23H26N6O3 — CID 23482529
6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine (PubChem CID 23482529) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23482529 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine |
| SMILES | COc1cccc(Nc2ncnc(N3CCN(c4cccc(C)c4C)CC3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26N6O3/c1-16-6-4-9-20(17(16)2)27-10-12-28(13-11-27)23-21(29(30)31)22(24-15-25-23)26-18-7-5-8-19(14-18)32-3/h4-9,14-15H,10-13H2,1-3H3,(H,24,25,26) |
| InChIKey | SPWKRINXYQLHDJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|