C20H28N6O3 — CID 22526581
6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxypropyl)-5-nitropyrimidin-4-amine (PubChem CID 22526581) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxypropyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxypropyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22526581 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-methoxypropyl)-5-nitropyrimidin-4-amine |
| SMILES | COCCCNc1ncnc(N2CCN(c3cccc(C)c3C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28N6O3/c1-15-6-4-7-17(16(15)2)24-9-11-25(12-10-24)20-18(26(27)28)19(22-14-23-20)21-8-5-13-29-3/h4,6-7,14H,5,8-13H2,1-3H3,(H,21,22,23) |
| InChIKey | BYFONOHJMLOLJB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|