C18H23N5O2 — CID 19138144
1-[5-amino-6-(2-phenylethylamino)pyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 19138144) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-[5-amino-6-(2-phenylethylamino)pyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[5-amino-6-(2-phenylethylamino)pyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 19138144 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[5-amino-6-(2-phenylethylamino)pyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | Nc1c(NCCc2ccccc2)ncnc1N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C18H23N5O2/c19-15-16(20-9-6-13-4-2-1-3-5-13)21-12-22-17(15)23-10-7-14(8-11-23)18(24)25/h1-5,12,14H,6-11,19H2,(H,24,25)(H,20,21,22) |
| InChIKey | JFRQZSULIGJYGD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |